- 3C-E
Chembox new
ImageFile1 = 3C-E.svg
ImageSize1 = 180px
IUPACName = 1-(4-Ethoxy-3,5-dimethoxyphenyl)propan-2-amine
OtherNames = 3,5-Dimethoxy-4-ethoxy-amphetamine
Section1 = Chembox Identifiers
CASNo = 146849-92-5
PubChem =
SMILES = NC(C)CC1=CC(OC)=C(OCC)C(OC)=C1
Section2 = Chembox Properties
Formula = C13H21NO3
MolarMass = 239.31 g/mol
Appearance =
Density =
MeltingPt =
BoilingPt =
Solubility =
Section3 = Chembox Hazards
MainHazards =
FlashPt =
Autoignition =3C-E is a
psychedelic hallucinogenic drug andentheogen of thephenethylamine class of compounds. It is asubstituted amphetamine . 3C-E was probably first synthesized byAlexander Shulgin . In his book "PiHKAL (Phenethylamines i Have Known And Loved)", Shulgin lists the dosage range as 30 to 60 mg, consumed orally. The duration of action was stated to be 8-12 hours. [CitePiHKAL] 3C-E can be considered illegal in the U.S. as a result of the Analogue Act, although it is not itself scheduled; it is also illegal inAustralia .This compound is the three-carbon chain analogue of
escaline .References
External links
* [http://www.erowid.org/library/books_online/pihkal/pihkal025.shtml PiHKAL entry]
Categorization
Wikimedia Foundation. 2010.